About N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide
N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide (PubChem CID 51131311) has the molecular formula C13H25N5O3S
and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide |
| PubChem CID | 51131311 |
| Molecular Formula | C13H25N5O3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide |
| SMILES | Cc1nn(C)c(N2CCOCC2)c1CNCCNS(C)(=O)=O |
| InChI | InChI=1S/C13H25N5O3S/c1-11-12(10-14-4-5-15-22(3,19)20)13(17(2)16-11)18-6-8-21-9-7-18/h14-15H,4-10H2,1-3H3 |
| InChIKey | IWCOMHWSSGFFBL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide?
The IUPAC name of N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide (CID 51131311) is N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide.
What is the SMILES notation for N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide?
The canonical SMILES for N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide is Cc1nn(C)c(N2CCOCC2)c1CNCCNS(C)(=O)=O.
What is the InChIKey of N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide?
The InChIKey is IWCOMHWSSGFFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5O3S/c1-11-12(10-14-4-5-15-22(3,19)20)13(17(2)16-11)18-6-8-21-9-7-18/h14-15H,4-10H2,1-3H3.
What are the key properties of N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide?
N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide has a molecular weight of 331.44 g/mol, XLogP of -0.80, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methylamino]ethyl]methanesulfonamide is sourced from PubChem (CID 51131311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).