About N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine
N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine (PubChem CID 51131349) has the molecular formula C20H30N4O
and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine.
Molecular Properties
| Compound Name | N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine |
| PubChem CID | 51131349 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine |
| SMILES | Cc1ccccc1CC(C)NCc1c(C)nn(C)c1N1CCOCC1 |
| InChI | InChI=1S/C20H30N4O/c1-15-7-5-6-8-18(15)13-16(2)21-14-19-17(3)22-23(4)20(19)24-9-11-25-12-10-24/h5-8,16,21H,9-14H2,1-4H3 |
| InChIKey | OLPRGNDWCBZECB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine?
The IUPAC name of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine (CID 51131349) is N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine.
What is the SMILES notation for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine?
The canonical SMILES for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine is Cc1ccccc1CC(C)NCc1c(C)nn(C)c1N1CCOCC1.
What is the InChIKey of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine?
The InChIKey is OLPRGNDWCBZECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O/c1-15-7-5-6-8-18(15)13-16(2)21-14-19-17(3)22-23(4)20(19)24-9-11-25-12-10-24/h5-8,16,21H,9-14H2,1-4H3.
What are the key properties of N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine?
N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine has a molecular weight of 342.49 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethyl-5-morpholin-4-ylpyrazol-4-yl)methyl]-1-(2-methylphenyl)propan-2-amine is sourced from PubChem (CID 51131349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).