About 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine (PubChem CID 51131456) has the molecular formula C11H24N4O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine.
Molecular Properties
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine |
| PubChem CID | 51131456 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H24N4O/c1-9-7-15(8-10(2)16-9)6-4-5-14-11(12)13-3/h9-10H,4-8H2,1-3H3,(H3,12,13,14) |
| InChIKey | YZNGQORGEQGOFK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine?
The IUPAC name of 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine (CID 51131456) is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine.
What is the SMILES notation for 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine?
The canonical SMILES for 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine is C/N=C(\N)NCCCN1CC(C)OC(C)C1.
What is the InChIKey of 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine?
The InChIKey is YZNGQORGEQGOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N4O/c1-9-7-15(8-10(2)16-9)6-4-5-14-11(12)13-3/h9-10H,4-8H2,1-3H3,(H3,12,13,14).
What are the key properties of 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine?
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine has a molecular weight of 228.34 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine is sourced from PubChem (CID 51131456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).