C13H19FIN3O — CID 51131535
N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 51131535) has the molecular formula C13H19FIN3O and a molecular weight of 379.22 g/mol. Its IUPAC name is N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 51131535 |
| Molecular Formula | C13H19FIN3O |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[3-(4-fluorophenoxy)propyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Fc1ccc(OCCCNC2=NCCCN2)cc1.I |
| InChI | InChI=1S/C13H18FN3O.HI/c14-11-3-5-12(6-4-11)18-10-2-9-17-13-15-7-1-8-16-13;/h3-6H,1-2,7-10H2,(H2,15,16,17);1H |
| InChIKey | HFWSBEQYTQGICY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|