C29H35ClO5 — CID 5113177
methyl 5-[2-[2-[(4-chlorobenzoyl)oxymethyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 5113177) has the molecular formula C29H35ClO5 and a molecular weight of 499.05 g/mol. Its IUPAC name is methyl 5-[2-[2-[(4-chlorobenzoyl)oxymethyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl 5-[2-[2-[(4-chlorobenzoyl)oxymethyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 5113177 |
| Molecular Formula | C29H35ClO5 |
| Molecular Weight | 499.05 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | methyl 5-[2-[2-[(4-chlorobenzoyl)oxymethyl]furan-3-yl]ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CCC2C(C)(C(=O)OC)CCCC2(C)C1CCc1ccoc1COC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H35ClO5/c1-19-6-13-25-28(2,15-5-16-29(25,3)27(32)33-4)23(19)12-9-20-14-17-34-24(20)18-35-26(31)21-7-10-22(30)11-8-21/h7-8,10-11,14,17,23,25H,1,5-6,9,12-13,15-16,18H2,2-4H3 |
| InChIKey | GWRGBUFHKHVTFS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.05 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|