About methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate
methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate (PubChem CID 51132529) has the molecular formula C18H14Cl2N2O3
and a molecular weight of 377.23 g/mol. Its IUPAC name is methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate |
| PubChem CID | 51132529 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccc(Cl)c(Cl)c1)N(C)C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-22(17(23)12-5-3-11(10-21)4-6-12)16(18(24)25-2)13-7-8-14(19)15(20)9-13/h3-9,16H,1-2H3 |
| InChIKey | SUCDBKFGVADEQI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate?
The IUPAC name of methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate (CID 51132529) is methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate.
What is the SMILES notation for methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate?
The canonical SMILES for methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate is COC(=O)C(c1ccc(Cl)c(Cl)c1)N(C)C(=O)c1ccc(C#N)cc1.
What is the InChIKey of methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate?
The InChIKey is SUCDBKFGVADEQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2N2O3/c1-22(17(23)12-5-3-11(10-21)4-6-12)16(18(24)25-2)13-7-8-14(19)15(20)9-13/h3-9,16H,1-2H3.
What are the key properties of methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate?
methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate has a molecular weight of 377.23 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-cyanobenzoyl)-methylamino]-2-(3,4-dichlorophenyl)acetate is sourced from PubChem (CID 51132529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).