C14H13N3O2S2 — CID 5113255
N-(2,6-dimethylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 5113255) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-(2,6-dimethylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 5113255 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C14H13N3O2S2/c1-9-5-3-6-10(2)13(9)17-21(18,19)12-8-4-7-11-14(12)16-20-15-11/h3-8,17H,1-2H3 |
| InChIKey | ZVCLOBCXUXQPKY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|