C16H20Cl2N4O3 — CID 51133255
2-[4-[(4-chloro-3-nitrophenyl)methylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethanol;hydrochloride (PubChem CID 51133255) has the molecular formula C16H20Cl2N4O3 and a molecular weight of 387.27 g/mol. Its IUPAC name is 2-[4-[(4-chloro-3-nitrophenyl)methylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-[(4-chloro-3-nitrophenyl)methylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 51133255 |
| Molecular Formula | C16H20Cl2N4O3 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[4-[(4-chloro-3-nitrophenyl)methylamino]-4,5,6,7-tetrahydroindazol-1-yl]ethanol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(CNC2CCCc3c2cnn3CCO)ccc1Cl |
| InChI | InChI=1S/C16H19ClN4O3.ClH/c17-13-5-4-11(8-16(13)21(23)24)9-18-14-2-1-3-15-12(14)10-19-20(15)6-7-22;/h4-5,8,10,14,18,22H,1-3,6-7,9H2;1H |
| InChIKey | DJRVDOAIFPUDAV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|