About 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one
5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 5113368) has the molecular formula C10H9N5O3
and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 5113368 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | Cc1[nH][nH]c(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H9N5O3/c1-6-9(10(16)14-11-6)13-12-7-2-4-8(5-3-7)15(17)18/h2-5H,1H3,(H2,11,14,16)/b13-12+ |
| InChIKey | MBJVOXNNRXUMKI-OUKQBFOZSA-N |
| XLogP | 2.34 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one (CID 5113368) is 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one is Cc1[nH][nH]c(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The InChIKey is MBJVOXNNRXUMKI-OUKQBFOZSA-N. The full InChI is InChI=1S/C10H9N5O3/c1-6-9(10(16)14-11-6)13-12-7-2-4-8(5-3-7)15(17)18/h2-5H,1H3,(H2,11,14,16)/b13-12+.
What are the key properties of 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one has a molecular weight of 247.21 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-[(4-nitrophenyl)diazenyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 5113368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).