C20H26N2O4S2 — CID 51133895
4-N-[2,4-bis(methylsulfonyl)phenyl]-1-N-(cyclopentylmethyl)benzene-1,4-diamine (PubChem CID 51133895) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-N-[2,4-bis(methylsulfonyl)phenyl]-1-N-(cyclopentylmethyl)benzene-1,4-diamine.
| Compound Name | 4-N-[2,4-bis(methylsulfonyl)phenyl]-1-N-(cyclopentylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 51133895 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-N-[2,4-bis(methylsulfonyl)phenyl]-1-N-(cyclopentylmethyl)benzene-1,4-diamine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ccc(NCC3CCCC3)cc2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-27(23,24)18-11-12-19(20(13-18)28(2,25)26)22-17-9-7-16(8-10-17)21-14-15-5-3-4-6-15/h7-13,15,21-22H,3-6,14H2,1-2H3 |
| InChIKey | BARPUXMHQYAPRU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|