About 3-(azepan-1-yl)-2,1-benzothiazole
3-(azepan-1-yl)-2,1-benzothiazole (PubChem CID 51133929) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-(azepan-1-yl)-2,1-benzothiazole.
Molecular Properties
| Compound Name | 3-(azepan-1-yl)-2,1-benzothiazole |
| PubChem CID | 51133929 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(azepan-1-yl)-2,1-benzothiazole |
| SMILES | c1ccc2c(N3CCCCCC3)snc2c1 |
| InChI | InChI=1S/C13H16N2S/c1-2-6-10-15(9-5-1)13-11-7-3-4-8-12(11)14-16-13/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | WGMASJUGLDJBAH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(azepan-1-yl)-2,1-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-1-yl)-2,1-benzothiazole?
The IUPAC name of 3-(azepan-1-yl)-2,1-benzothiazole (CID 51133929) is 3-(azepan-1-yl)-2,1-benzothiazole.
What is the SMILES notation for 3-(azepan-1-yl)-2,1-benzothiazole?
The canonical SMILES for 3-(azepan-1-yl)-2,1-benzothiazole is c1ccc2c(N3CCCCCC3)snc2c1.
What is the InChIKey of 3-(azepan-1-yl)-2,1-benzothiazole?
The InChIKey is WGMASJUGLDJBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S/c1-2-6-10-15(9-5-1)13-11-7-3-4-8-12(11)14-16-13/h3-4,7-8H,1-2,5-6,9-10H2.
What are the key properties of 3-(azepan-1-yl)-2,1-benzothiazole?
3-(azepan-1-yl)-2,1-benzothiazole has a molecular weight of 232.35 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-1-yl)-2,1-benzothiazole is sourced from PubChem (CID 51133929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).