C25H28N8O2 — CID 51134108
1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea (PubChem CID 51134108) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea.
| Compound Name | 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea |
|---|---|
| PubChem CID | 51134108 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea |
| SMILES | O=C(Nc1cccc(-c2nnnn2C2CC2)c1)Nc1ccc2c(ccn2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C25H28N8O2/c34-25(26-20-3-1-2-19(17-20)24-28-29-30-33(24)22-5-6-22)27-21-4-7-23-18(16-21)8-9-32(23)11-10-31-12-14-35-15-13-31/h1-4,7-9,16-17,22H,5-6,10-15H2,(H2,26,27,34) |
| InChIKey | ORDMJKCXEXRHMA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |