C22H21Cl2N5O2 — CID 5113419
N-[4-[7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenyl]acetamide (PubChem CID 5113419) has the molecular formula C22H21Cl2N5O2 and a molecular weight of 458.35 g/mol. Its IUPAC name is N-[4-[7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenyl]acetamide.
| Compound Name | N-[4-[7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 5113419 |
| Molecular Formula | C22H21Cl2N5O2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-[4-[7-(2,4-dichlorophenyl)-2-(3-hydroxypropyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=CC(c3ccc(Cl)cc3Cl)n3nc(CCCO)nc3N2)cc1 |
| InChI | InChI=1S/C22H21Cl2N5O2/c1-13(31)25-16-7-4-14(5-8-16)19-12-20(17-9-6-15(23)11-18(17)24)29-22(26-19)27-21(28-29)3-2-10-30/h4-9,11-12,20,30H,2-3,10H2,1H3,(H,25,31)(H,26,27,28) |
| InChIKey | ALAMOKAPKYPNSU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |