C21H22ClN7 — CID 51134816
N'-[1-(3-chlorophenyl)-6-methylpyrazolo[3,4-d]pyrimidin-4-yl]-N-pyridin-2-ylbutane-1,4-diamine (PubChem CID 51134816) has the molecular formula C21H22ClN7 and a molecular weight of 407.91 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)-6-methylpyrazolo[3,4-d]pyrimidin-4-yl]-N-pyridin-2-ylbutane-1,4-diamine.
| Compound Name | N'-[1-(3-chlorophenyl)-6-methylpyrazolo[3,4-d]pyrimidin-4-yl]-N-pyridin-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 51134816 |
| Molecular Formula | C21H22ClN7 |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N'-[1-(3-chlorophenyl)-6-methylpyrazolo[3,4-d]pyrimidin-4-yl]-N-pyridin-2-ylbutane-1,4-diamine |
| SMILES | Cc1nc(NCCCCNc2ccccn2)c2cnn(-c3cccc(Cl)c3)c2n1 |
| InChI | InChI=1S/C21H22ClN7/c1-15-27-20(25-12-5-4-11-24-19-9-2-3-10-23-19)18-14-26-29(21(18)28-15)17-8-6-7-16(22)13-17/h2-3,6-10,13-14H,4-5,11-12H2,1H3,(H,23,24)(H,25,27,28) |
| InChIKey | CGYCVOAPRIDTSD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|