About tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate
tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate (PubChem CID 51135964) has the molecular formula C14H23N3O4
and a molecular weight of 297.36 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate.
Molecular Properties
| Compound Name | tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate |
| PubChem CID | 51135964 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate |
| SMILES | Cc1cc(NC(=O)N(C)CCCC(=O)OC(C)(C)C)no1 |
| InChI | InChI=1S/C14H23N3O4/c1-10-9-11(16-21-10)15-13(19)17(5)8-6-7-12(18)20-14(2,3)4/h9H,6-8H2,1-5H3,(H,15,16,19) |
| InChIKey | UUYNZXUFQPARJB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate?
The IUPAC name of tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate (CID 51135964) is tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate.
What is the SMILES notation for tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate?
The canonical SMILES for tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate is Cc1cc(NC(=O)N(C)CCCC(=O)OC(C)(C)C)no1.
What is the InChIKey of tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate?
The InChIKey is UUYNZXUFQPARJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O4/c1-10-9-11(16-21-10)15-13(19)17(5)8-6-7-12(18)20-14(2,3)4/h9H,6-8H2,1-5H3,(H,15,16,19).
What are the key properties of tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate?
tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate has a molecular weight of 297.36 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[methyl-[(5-methyl-1,2-oxazol-3-yl)carbamoyl]amino]butanoate is sourced from PubChem (CID 51135964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).