About CID 51136058
CID 51136058 (PubChem CID 51136058) has the molecular formula C19H26N5O
and a molecular weight of 340.45 g/mol.
Molecular Properties
| Compound Name | CID 51136058 |
| PubChem CID | 51136058 |
| Molecular Formula | C19H26N5O |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | — |
| SMILES | Cc1cc2n(n1)CC(CNCc1ccc(OC3CCCC3)nc1)C[N]2 |
| InChI | InChI=1S/C19H26N5O/c1-14-8-18-21-12-16(13-24(18)23-14)10-20-9-15-6-7-19(22-11-15)25-17-4-2-3-5-17/h6-8,11,16-17,20H,2-5,9-10,12-13H2,1H3 |
| InChIKey | YGLAUYKUNAROFW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 51136058 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 51136058?
The IUPAC name of CID 51136058 (CID 51136058) is not available.
What is the SMILES notation for CID 51136058?
The canonical SMILES for CID 51136058 is Cc1cc2n(n1)CC(CNCc1ccc(OC3CCCC3)nc1)C[N]2.
What is the InChIKey of CID 51136058?
The InChIKey is YGLAUYKUNAROFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N5O/c1-14-8-18-21-12-16(13-24(18)23-14)10-20-9-15-6-7-19(22-11-15)25-17-4-2-3-5-17/h6-8,11,16-17,20H,2-5,9-10,12-13H2,1H3.
What are the key properties of CID 51136058?
CID 51136058 has a molecular weight of 340.45 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 51136058 is sourced from PubChem (CID 51136058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).