C19H26N5O — CID 51136058
CID 51136058 (PubChem CID 51136058) has the molecular formula C19H26N5O and a molecular weight of 340.45 g/mol.
| Compound Name | CID 51136058 |
|---|---|
| PubChem CID | 51136058 |
| Molecular Formula | C19H26N5O |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | — |
| SMILES | Cc1cc2n(n1)CC(CNCc1ccc(OC3CCCC3)nc1)C[N]2 |
| InChI | InChI=1S/C19H26N5O/c1-14-8-18-21-12-16(13-24(18)23-14)10-20-9-15-6-7-19(22-11-15)25-17-4-2-3-5-17/h6-8,11,16-17,20H,2-5,9-10,12-13H2,1H3 |
| InChIKey | YGLAUYKUNAROFW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |