C22H34N4O4 — CID 51136279
1-[2-[[3-methyl-2-[methyl-[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 51136279) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[2-[[3-methyl-2-[methyl-[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[[3-methyl-2-[methyl-[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51136279 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 1-[2-[[3-methyl-2-[methyl-[(2E,4E,6E)-octa-2,4,6-trienoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | C/C=C/C=C/C=C/C(=O)N(C)C(C(=O)NC(C)C(=O)N1CCCC1C(N)=O)C(C)C |
| InChI | InChI=1S/C22H34N4O4/c1-6-7-8-9-10-13-18(27)25(5)19(15(2)3)21(29)24-16(4)22(30)26-14-11-12-17(26)20(23)28/h6-10,13,15-17,19H,11-12,14H2,1-5H3,(H2,23,28)(H,24,29)/b7-6+,9-8+,13-10+ |
| InChIKey | FADHJFXHKLXQOJ-NRWMFWRASA-N |
| XLogP | 1.14 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|