C21H36O3 — CID 51136336
1-(2-butan-2-yl-5-hydroxy-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)-3-hydroxypropan-1-one (PubChem CID 51136336) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 1-(2-butan-2-yl-5-hydroxy-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)-3-hydroxypropan-1-one.
| Compound Name | 1-(2-butan-2-yl-5-hydroxy-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 51136336 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 1-(2-butan-2-yl-5-hydroxy-1,3,6,8-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)-3-hydroxypropan-1-one |
| SMILES | CCC(C)C1C(C)=CC2C(O)C(C)CC(C)C2C1(C)C(=O)CCO |
| InChI | InChI=1S/C21H36O3/c1-7-12(2)18-14(4)11-16-19(13(3)10-15(5)20(16)24)21(18,6)17(23)8-9-22/h11-13,15-16,18-20,22,24H,7-10H2,1-6H3 |
| InChIKey | INRRKSNDPRKXCH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|