About 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide
1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide (PubChem CID 5113634) has the molecular formula C23H34N4O
and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide |
| PubChem CID | 5113634 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2ccc3c(c2)ncn3C2CCCC2)C1 |
| InChI | InChI=1S/C23H34N4O/c1-17-12-18(2)15-26(14-17)11-5-10-24-23(28)19-8-9-22-21(13-19)25-16-27(22)20-6-3-4-7-20/h8-9,13,16-18,20H,3-7,10-12,14-15H2,1-2H3,(H,24,28) |
| InChIKey | MXDHDTCJBCRPJV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide (CID 5113634) is 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide is CC1CC(C)CN(CCCNC(=O)c2ccc3c(c2)ncn3C2CCCC2)C1.
What is the InChIKey of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide?
The InChIKey is MXDHDTCJBCRPJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N4O/c1-17-12-18(2)15-26(14-17)11-5-10-24-23(28)19-8-9-22-21(13-19)25-16-27(22)20-6-3-4-7-20/h8-9,13,16-18,20H,3-7,10-12,14-15H2,1-2H3,(H,24,28).
What are the key properties of 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide?
1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide has a molecular weight of 382.55 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzimidazole-5-carboxamide is sourced from PubChem (CID 5113634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).