C20H34O3 — CID 51136415
1-(2-hydroxypropan-2-yl)-3a-methyl-6,10-dimethylidene-2,3,4,5,7,8,9,11,12,12a-decahydro-1H-cyclopenta[11]annulene-5,9-diol (PubChem CID 51136415) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(2-hydroxypropan-2-yl)-3a-methyl-6,10-dimethylidene-2,3,4,5,7,8,9,11,12,12a-decahydro-1H-cyclopenta[11]annulene-5,9-diol.
| Compound Name | 1-(2-hydroxypropan-2-yl)-3a-methyl-6,10-dimethylidene-2,3,4,5,7,8,9,11,12,12a-decahydro-1H-cyclopenta[11]annulene-5,9-diol |
|---|---|
| PubChem CID | 51136415 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1-(2-hydroxypropan-2-yl)-3a-methyl-6,10-dimethylidene-2,3,4,5,7,8,9,11,12,12a-decahydro-1H-cyclopenta[11]annulene-5,9-diol |
| SMILES | C=C1CCC2C(C(C)(C)O)CCC2(C)CC(O)C(=C)CCC1O |
| InChI | InChI=1S/C20H34O3/c1-13-6-8-16-15(19(3,4)23)10-11-20(16,5)12-18(22)14(2)7-9-17(13)21/h15-18,21-23H,1-2,6-12H2,3-5H3 |
| InChIKey | GOGZROZDRLVTLW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|