C12H17NO7 — CID 51136506
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-methylpyrrole-2-carboxylate (PubChem CID 51136506) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-methylpyrrole-2-carboxylate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 51136506 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cccc1C(=O)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17NO7/c1-13-4-2-3-6(13)11(18)20-12-10(17)9(16)8(15)7(5-14)19-12/h2-4,7-10,12,14-17H,5H2,1H3/t7-,8-,9+,10-,12+/m1/s1 |
| InChIKey | VCOMCDMBIRHZAE-GPTQDWHKSA-N |
| XLogP | -2.02 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |