C26H40O8 — CID 51136551
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate (PubChem CID 51136551) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
|---|---|
| PubChem CID | 51136551 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 5,9,13-trimethyl-14-oxotetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylate |
| SMILES | CC12CCC3C(CCC4C(C)(C(=O)OC5OC(CO)C(O)C(O)C5O)CCCC34C)(CC1=O)C2 |
| InChI | InChI=1S/C26H40O8/c1-23-9-5-16-24(2)7-4-8-25(3,15(24)6-10-26(16,13-23)11-17(23)28)22(32)34-21-20(31)19(30)18(29)14(12-27)33-21/h14-16,18-21,27,29-31H,4-13H2,1-3H3 |
| InChIKey | MXPANPFFHMVCBQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |