About 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone
1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 51137034) has the molecular formula C13H13FN2O2
and a molecular weight of 248.26 g/mol. Its IUPAC name is 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 51137034 |
| Molecular Formula | C13H13FN2O2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H](c2nc3cc(F)ccc3o2)C1 |
| InChI | InChI=1S/C13H13FN2O2/c1-8(17)16-5-4-9(7-16)13-15-11-6-10(14)2-3-12(11)18-13/h2-3,6,9H,4-5,7H2,1H3/t9-/m0/s1 |
| InChIKey | LNSFQZLHHAZUBU-VIFPVBQESA-N |
| XLogP | 2.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone (CID 51137034) is 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone is CC(=O)N1CC[C@H](c2nc3cc(F)ccc3o2)C1.
What is the InChIKey of 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone?
The InChIKey is LNSFQZLHHAZUBU-VIFPVBQESA-N. The full InChI is InChI=1S/C13H13FN2O2/c1-8(17)16-5-4-9(7-16)13-15-11-6-10(14)2-3-12(11)18-13/h2-3,6,9H,4-5,7H2,1H3/t9-/m0/s1.
What are the key properties of 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone?
1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone has a molecular weight of 248.26 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-(5-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 51137034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).