C19H23N5 — CID 51137037
4-[[(3S)-3-(1H-imidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]methyl]-N,N-dimethylaniline (PubChem CID 51137037) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 4-[[(3S)-3-(1H-imidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[(3S)-3-(1H-imidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 51137037 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 4-[[(3S)-3-(1H-imidazo[4,5-b]pyridin-2-yl)pyrrolidin-1-yl]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CN2CC[C@H](c3nc4ncccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C19H23N5/c1-23(2)16-7-5-14(6-8-16)12-24-11-9-15(13-24)18-21-17-4-3-10-20-19(17)22-18/h3-8,10,15H,9,11-13H2,1-2H3,(H,20,21,22)/t15-/m0/s1 |
| InChIKey | RGPCGUJZMSSSOP-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|