About 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile
4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile (PubChem CID 51137384) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile |
| PubChem CID | 51137384 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC[C@H](c3nnc(Cc4ccccc4)o3)C2)cc1 |
| InChI | InChI=1S/C21H20N4O/c22-13-17-6-8-18(9-7-17)14-25-11-10-19(15-25)21-24-23-20(26-21)12-16-4-2-1-3-5-16/h1-9,19H,10-12,14-15H2/t19-/m0/s1 |
| InChIKey | CGHOFBYCOPZLKC-IBGZPJMESA-N |
| XLogP | 3.52 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile?
The IUPAC name of 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile (CID 51137384) is 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile?
The canonical SMILES for 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile is N#Cc1ccc(CN2CC[C@H](c3nnc(Cc4ccccc4)o3)C2)cc1.
What is the InChIKey of 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile?
The InChIKey is CGHOFBYCOPZLKC-IBGZPJMESA-N. The full InChI is InChI=1S/C21H20N4O/c22-13-17-6-8-18(9-7-17)14-25-11-10-19(15-25)21-24-23-20(26-21)12-16-4-2-1-3-5-16/h1-9,19H,10-12,14-15H2/t19-/m0/s1.
What are the key properties of 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile?
4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile has a molecular weight of 344.42 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3S)-3-(5-benzyl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 51137384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).