C22H31N3O2 — CID 51138126
(9S,11S)-N-(2-methoxyethyl)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide (PubChem CID 51138126) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (9S,11S)-N-(2-methoxyethyl)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide.
| Compound Name | (9S,11S)-N-(2-methoxyethyl)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 51138126 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (9S,11S)-N-(2-methoxyethyl)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraene-11-carboxamide |
| SMILES | C=CCn1cc2c3c(cccc31)[C@H](CC(C)C)N[C@H](C(=O)NCCOC)C2 |
| InChI | InChI=1S/C22H31N3O2/c1-5-10-25-14-16-13-19(22(26)23-9-11-27-4)24-18(12-15(2)3)17-7-6-8-20(25)21(16)17/h5-8,14-15,18-19,24H,1,9-13H2,2-4H3,(H,23,26)/t18-,19-/m0/s1 |
| InChIKey | PIBMECLPDZJQAJ-OALUTQOASA-N |
| XLogP | 3.19 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|