C23H31N3O2 — CID 51138130
[(9S,11S)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]-morpholin-4-ylmethanone (PubChem CID 51138130) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is [(9S,11S)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]-morpholin-4-ylmethanone.
| Compound Name | [(9S,11S)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 51138130 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | [(9S,11S)-9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]-morpholin-4-ylmethanone |
| SMILES | C=CCn1cc2c3c(cccc31)[C@H](CC(C)C)N[C@H](C(=O)N1CCOCC1)C2 |
| InChI | InChI=1S/C23H31N3O2/c1-4-8-26-15-17-14-20(23(27)25-9-11-28-12-10-25)24-19(13-16(2)3)18-6-5-7-21(26)22(17)18/h4-7,15-16,19-20,24H,1,8-14H2,2-3H3/t19-,20-/m0/s1 |
| InChIKey | VMZGAMVWOWTBEO-PMACEKPBSA-N |
| XLogP | 3.29 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|