C19H25NO5 — CID 51138457
3-acetyl-2-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 51138457) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-acetyl-2-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-2-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 51138457 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-acetyl-2-(4-ethoxyphenyl)-1-(3-ethoxypropyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCOCCCN1C(=O)C(O)=C(C(C)=O)C1c1ccc(OCC)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-4-24-12-6-11-20-17(16(13(3)21)18(22)19(20)23)14-7-9-15(10-8-14)25-5-2/h7-10,17,22H,4-6,11-12H2,1-3H3 |
| InChIKey | BLNWEFBQTTWORY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|