About 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole
4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole (PubChem CID 51138512) has the molecular formula C19H16O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole.
Molecular Properties
| Compound Name | 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole |
| PubChem CID | 51138512 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole |
| SMILES | COc1ccc(-c2cccc3cc(OC)c4c(c23)OCO4)cc1 |
| InChI | InChI=1S/C19H16O4/c1-20-14-8-6-12(7-9-14)15-5-3-4-13-10-16(21-2)18-19(17(13)15)23-11-22-18/h3-10H,11H2,1-2H3 |
| InChIKey | PKDXXLGDIJWCPI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole?
The IUPAC name of 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole (CID 51138512) is 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole.
What is the SMILES notation for 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole?
The canonical SMILES for 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole is COc1ccc(-c2cccc3cc(OC)c4c(c23)OCO4)cc1.
What is the InChIKey of 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole?
The InChIKey is PKDXXLGDIJWCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4/c1-20-14-8-6-12(7-9-14)15-5-3-4-13-10-16(21-2)18-19(17(13)15)23-11-22-18/h3-10H,11H2,1-2H3.
What are the key properties of 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole?
4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole has a molecular weight of 308.33 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-9-(4-methoxyphenyl)benzo[g][1,3]benzodioxole is sourced from PubChem (CID 51138512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).