About 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine
4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 51138522) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine |
| PubChem CID | 51138522 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1ccc(-c2onc(N)c2-c2cc(OC)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H16N2O5/c1-21-12-5-3-10(4-6-12)16-15(18(19)20-25-16)11-7-13(22-2)17-14(8-11)23-9-24-17/h3-8H,9H2,1-2H3,(H2,19,20) |
| InChIKey | IKRQSCFDNOOBER-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine?
The IUPAC name of 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine (CID 51138522) is 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine.
What is the SMILES notation for 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine?
The canonical SMILES for 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine is COc1ccc(-c2onc(N)c2-c2cc(OC)c3c(c2)OCO3)cc1.
What is the InChIKey of 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine?
The InChIKey is IKRQSCFDNOOBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5/c1-21-12-5-3-10(4-6-12)16-15(18(19)20-25-16)11-7-13(22-2)17-14(8-11)23-9-24-17/h3-8H,9H2,1-2H3,(H2,19,20).
What are the key properties of 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine?
4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine has a molecular weight of 340.34 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-methoxy-1,3-benzodioxol-5-yl)-5-(4-methoxyphenyl)-1,2-oxazol-3-amine is sourced from PubChem (CID 51138522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).