C18H19ClN4O2 — CID 51142146
N-[(4-chlorophenyl)methyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide (PubChem CID 51142146) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 51142146 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[2-(2-hydroxyethylamino)benzimidazol-1-yl]acetamide |
| SMILES | O=C(Cn1c(NCCO)nc2ccccc21)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN4O2/c19-14-7-5-13(6-8-14)11-21-17(25)12-23-16-4-2-1-3-15(16)22-18(23)20-9-10-24/h1-8,24H,9-12H2,(H,20,22)(H,21,25) |
| InChIKey | AKIJDKAPDIKYLX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |