About methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane
methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane (PubChem CID 5114394) has the molecular formula C21H37BO
and a molecular weight of 316.34 g/mol. Its IUPAC name is methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane.
Molecular Properties
| Compound Name | methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
| PubChem CID | 5114394 |
| Molecular Formula | C21H37BO |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane |
| SMILES | COB(C1CC2CC(C1C)C2(C)C)C1CC2CC(C1C)C2(C)C |
| InChI | InChI=1S/C21H37BO/c1-12-16-8-14(20(16,3)4)10-18(12)22(23-7)19-11-15-9-17(13(19)2)21(15,5)6/h12-19H,8-11H2,1-7H3 |
| InChIKey | IAQXEQYLQNNXJC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The IUPAC name of methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane (CID 5114394) is methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane.
What is the SMILES notation for methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The canonical SMILES for methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane is COB(C1CC2CC(C1C)C2(C)C)C1CC2CC(C1C)C2(C)C.
What is the InChIKey of methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
The InChIKey is IAQXEQYLQNNXJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37BO/c1-12-16-8-14(20(16,3)4)10-18(12)22(23-7)19-11-15-9-17(13(19)2)21(15,5)6/h12-19H,8-11H2,1-7H3.
What are the key properties of methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane?
methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane has a molecular weight of 316.34 g/mol, XLogP of 5.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy-bis(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)borane is sourced from PubChem (CID 5114394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).