About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine (PubChem CID 5114603) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine |
| PubChem CID | 5114603 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine |
| SMILES | Cc1cc(C)nc(SC(C)CN(C)C)n1 |
| InChI | InChI=1S/C11H19N3S/c1-8-6-9(2)13-11(12-8)15-10(3)7-14(4)5/h6,10H,7H2,1-5H3 |
| InChIKey | CLPQXQQJCIDIAS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine (CID 5114603) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine is Cc1cc(C)nc(SC(C)CN(C)C)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine?
The InChIKey is CLPQXQQJCIDIAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S/c1-8-6-9(2)13-11(12-8)15-10(3)7-14(4)5/h6,10H,7H2,1-5H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine has a molecular weight of 225.36 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 5114603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).