About 3-tricyclo[5.3.1.03,8]undecanylmethanol
3-tricyclo[5.3.1.03,8]undecanylmethanol (PubChem CID 511461) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 3-tricyclo[5.3.1.03,8]undecanylmethanol.
Molecular Properties
| Compound Name | 3-tricyclo[5.3.1.03,8]undecanylmethanol |
| PubChem CID | 511461 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3-tricyclo[5.3.1.03,8]undecanylmethanol |
| SMILES | OCC12CCCC3CC(CCC31)C2 |
| InChI | InChI=1S/C12H20O/c13-8-12-5-1-2-10-6-9(7-12)3-4-11(10)12/h9-11,13H,1-8H2 |
| InChIKey | UKVUHGGTSTXOOF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tricyclo[5.3.1.03,8]undecanylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tricyclo[5.3.1.03,8]undecanylmethanol?
The IUPAC name of 3-tricyclo[5.3.1.03,8]undecanylmethanol (CID 511461) is 3-tricyclo[5.3.1.03,8]undecanylmethanol.
What is the SMILES notation for 3-tricyclo[5.3.1.03,8]undecanylmethanol?
The canonical SMILES for 3-tricyclo[5.3.1.03,8]undecanylmethanol is OCC12CCCC3CC(CCC31)C2.
What is the InChIKey of 3-tricyclo[5.3.1.03,8]undecanylmethanol?
The InChIKey is UKVUHGGTSTXOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c13-8-12-5-1-2-10-6-9(7-12)3-4-11(10)12/h9-11,13H,1-8H2.
What are the key properties of 3-tricyclo[5.3.1.03,8]undecanylmethanol?
3-tricyclo[5.3.1.03,8]undecanylmethanol has a molecular weight of 180.29 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tricyclo[5.3.1.03,8]undecanylmethanol is sourced from PubChem (CID 511461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).