C17H16N2O3S — CID 5114817
2-(1,3-benzodioxol-5-yl)-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 5114817) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 5114817 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCSC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O3S/c20-17(18-13-4-2-1-3-5-13)19-8-9-23-16(19)12-6-7-14-15(10-12)22-11-21-14/h1-7,10,16H,8-9,11H2,(H,18,20) |
| InChIKey | SBFHHYRLJMBQFI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |