C16H19N3O3 — CID 51148639
N-[3-(diethylcarbamoyl)phenyl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 51148639) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[3-(diethylcarbamoyl)phenyl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(diethylcarbamoyl)phenyl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 51148639 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[3-(diethylcarbamoyl)phenyl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)c2cc(C)on2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-19(5-2)16(21)12-7-6-8-13(10-12)17-15(20)14-9-11(3)22-18-14/h6-10H,4-5H2,1-3H3,(H,17,20) |
| InChIKey | GTDYGYXFABLFRQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |