C16H15F2NO3S — CID 51149413
2-(difluoromethoxy)-3-methoxy-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 51149413) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-(difluoromethoxy)-3-methoxy-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 2-(difluoromethoxy)-3-methoxy-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 51149413 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(difluoromethoxy)-3-methoxy-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC)c2)c1OC(F)F |
| InChI | InChI=1S/C16H15F2NO3S/c1-21-13-8-4-7-12(14(13)22-16(17)18)15(20)19-10-5-3-6-11(9-10)23-2/h3-9,16H,1-2H3,(H,19,20) |
| InChIKey | NIQGJSKIBJSHLE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |