C18H25N3O4 — CID 51149886
tert-butyl 2-[(3-acetamidophenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 51149886) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl 2-[(3-acetamidophenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(3-acetamidophenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 51149886 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 2-[(3-acetamidophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(=O)Nc1cccc(NC(=O)C2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H25N3O4/c1-12(22)19-13-7-5-8-14(11-13)20-16(23)15-9-6-10-21(15)17(24)25-18(2,3)4/h5,7-8,11,15H,6,9-10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | VQPCISVSMGZKSW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |