C18H24N2O2S — CID 51150273
N-[1-(2,5-dimethylphenyl)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 51150273) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 51150273 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)C2CSC3(C)CCC(=O)N23)c1 |
| InChI | InChI=1S/C18H24N2O2S/c1-11-5-6-12(2)14(9-11)13(3)19-17(22)15-10-23-18(4)8-7-16(21)20(15)18/h5-6,9,13,15H,7-8,10H2,1-4H3,(H,19,22) |
| InChIKey | OQHDEIDYHOKEET-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |