About ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate
ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (PubChem CID 5115064) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| PubChem CID | 5115064 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate |
| SMILES | CCOC(=O)C(=O)c1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C17H14N2O3/c1-2-22-17(21)16(20)15-14(12-8-4-3-5-9-12)18-13-10-6-7-11-19(13)15/h3-11H,2H2,1H3 |
| InChIKey | PUNQZWZQISOPOW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The IUPAC name of ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate (CID 5115064) is ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate.
What is the SMILES notation for ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The canonical SMILES for ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate is CCOC(=O)C(=O)c1c(-c2ccccc2)nc2ccccn12.
What is the InChIKey of ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
The InChIKey is PUNQZWZQISOPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c1-2-22-17(21)16(20)15-14(12-8-4-3-5-9-12)18-13-10-6-7-11-19(13)15/h3-11H,2H2,1H3.
What are the key properties of ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate?
ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate has a molecular weight of 294.31 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-2-(2-phenylimidazo[1,2-a]pyridin-3-yl)acetate is sourced from PubChem (CID 5115064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).