C20H25N3O4 — CID 51153821
methyl 1-[3-(2-methylpropyl)-4-oxophthalazine-1-carbonyl]piperidine-4-carboxylate (PubChem CID 51153821) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 1-[3-(2-methylpropyl)-4-oxophthalazine-1-carbonyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[3-(2-methylpropyl)-4-oxophthalazine-1-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51153821 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methyl 1-[3-(2-methylpropyl)-4-oxophthalazine-1-carbonyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2nn(CC(C)C)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H25N3O4/c1-13(2)12-23-18(24)16-7-5-4-6-15(16)17(21-23)19(25)22-10-8-14(9-11-22)20(26)27-3/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | GNAKNTXUIKNEBL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |