C20H28N4O4 — CID 51153903
(E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(5-methylfuran-2-yl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 51153903) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(5-methylfuran-2-yl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(5-methylfuran-2-yl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 51153903 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | (E)-N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-(5-methylfuran-2-yl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CCCCn1c(N)c(N(CC(C)C)C(=O)/C=C/c2ccc(C)o2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H28N4O4/c1-5-6-11-23-18(21)17(19(26)22-20(23)27)24(12-13(2)3)16(25)10-9-15-8-7-14(4)28-15/h7-10,13H,5-6,11-12,21H2,1-4H3,(H,22,26,27)/b10-9+ |
| InChIKey | NHFUOPWZXRTNME-MDZDMXLPSA-N |
| XLogP | 2.52 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|