C12H10F3N3O3S2 — CID 51154079
2,2-dioxo-N-(2,2,2-trifluoroethyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide (PubChem CID 51154079) has the molecular formula C12H10F3N3O3S2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 2,2-dioxo-N-(2,2,2-trifluoroethyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide.
| Compound Name | 2,2-dioxo-N-(2,2,2-trifluoroethyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
|---|---|
| PubChem CID | 51154079 |
| Molecular Formula | C12H10F3N3O3S2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 2,2-dioxo-N-(2,2,2-trifluoroethyl)-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc2c(c1)SC1=NS(=O)(=O)CCN12 |
| InChI | InChI=1S/C12H10F3N3O3S2/c13-12(14,15)6-16-10(19)7-1-2-8-9(5-7)22-11-17-23(20,21)4-3-18(8)11/h1-2,5H,3-4,6H2,(H,16,19) |
| InChIKey | PUBNYKDYWNIGTP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |