C20H31N3O3 — CID 51156967
N-ethyl-3-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-[(2-phenylacetyl)amino]butanamide (PubChem CID 51156967) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-ethyl-3-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-[(2-phenylacetyl)amino]butanamide.
| Compound Name | N-ethyl-3-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-[(2-phenylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 51156967 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N-ethyl-3-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-[(2-phenylacetyl)amino]butanamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)C(NC(=O)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H31N3O3/c1-6-23(13-18(25)21-15(4)5)20(26)19(14(2)3)22-17(24)12-16-10-8-7-9-11-16/h7-11,14-15,19H,6,12-13H2,1-5H3,(H,21,25)(H,22,24) |
| InChIKey | PLLRHJMBXKEHGD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |