C17H22N2O — CID 5116040
2-(3,3-dimethyl-2,4,6,7,8,9-hexahydrobenzo[g]isoquinolin-1-ylidene)acetamide (PubChem CID 5116040) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2,4,6,7,8,9-hexahydrobenzo[g]isoquinolin-1-ylidene)acetamide.
| Compound Name | 2-(3,3-dimethyl-2,4,6,7,8,9-hexahydrobenzo[g]isoquinolin-1-ylidene)acetamide |
|---|---|
| PubChem CID | 5116040 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 2-(3,3-dimethyl-2,4,6,7,8,9-hexahydrobenzo[g]isoquinolin-1-ylidene)acetamide |
| SMILES | CC1(C)Cc2cc3c(cc2C(=CC(N)=O)N1)CCCC3 |
| InChI | InChI=1S/C17H22N2O/c1-17(2)10-13-7-11-5-3-4-6-12(11)8-14(13)15(19-17)9-16(18)20/h7-9,19H,3-6,10H2,1-2H3,(H2,18,20) |
| InChIKey | NDTAOBPIXXRYAQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|