C21H24N2O5 — CID 51160617
N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 51160617) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 51160617 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)N2CCCc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O5/c1-26-17-11-15(12-18(27-2)20(17)28-3)21(25)22-13-19(24)23-10-6-8-14-7-4-5-9-16(14)23/h4-5,7,9,11-12H,6,8,10,13H2,1-3H3,(H,22,25) |
| InChIKey | MTBFICRVAGSLJE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |