C21H24N2O4 — CID 51161276
N-[2-(2-methoxyphenoxy)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 51161276) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 51161276 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | COc1ccccc1OCCNC(=O)C(C)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H24N2O4/c1-16(23-20(24)13-12-17-8-4-3-5-9-17)21(25)22-14-15-27-19-11-7-6-10-18(19)26-2/h3-13,16H,14-15H2,1-2H3,(H,22,25)(H,23,24)/b13-12+ |
| InChIKey | GEFRSTFTYTYLCG-OUKQBFOZSA-N |
| XLogP | 2.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|