C12H8F12N2OS — CID 5116170
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide (PubChem CID 5116170) has the molecular formula C12H8F12N2OS and a molecular weight of 456.25 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
|---|---|
| PubChem CID | 5116170 |
| Molecular Formula | C12H8F12N2OS |
| Molecular Weight | 456.25 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
| SMILES | Cc1nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)sc1C |
| InChI | InChI=1S/C12H8F12N2OS/c1-3-4(2)28-7(25-3)26-6(27)9(17,18)11(21,22)12(23,24)10(19,20)8(15,16)5(13)14/h5H,1-2H3,(H,25,26,27) |
| InChIKey | IUSSTMYQXWWLIT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|