C18H22N2O — CID 51161951
(3,5-dimethylpiperidin-1-yl)-(2-methylquinolin-4-yl)methanone (PubChem CID 51161951) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (3,5-dimethylpiperidin-1-yl)-(2-methylquinolin-4-yl)methanone.
| Compound Name | (3,5-dimethylpiperidin-1-yl)-(2-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 51161951 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3,5-dimethylpiperidin-1-yl)-(2-methylquinolin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC(C)CC(C)C2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22N2O/c1-12-8-13(2)11-20(10-12)18(21)16-9-14(3)19-17-7-5-4-6-15(16)17/h4-7,9,12-13H,8,10-11H2,1-3H3 |
| InChIKey | MRCQVBHXTJCVTC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |