C21H31N3O3 — CID 51162652
1-(cyclopropanecarbonyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]piperidine-4-carboxamide (PubChem CID 51162652) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]piperidine-4-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51162652 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)C1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C21H31N3O3/c25-20(16-8-12-24(13-9-16)21(26)17-6-7-17)22-15-18(19-5-4-14-27-19)23-10-2-1-3-11-23/h4-5,14,16-18H,1-3,6-13,15H2,(H,22,25) |
| InChIKey | DYGLFCYJEYGEDP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |